This compound is an Fmoc-protected, N-methylated amino acid derivative used as a building block in solid-phase peptide synthesis. It features a fluorenylmethoxycarbonyl (Fmoc) group for temporary protection of the amine during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 138775-22-1
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methylbutanoic acid
amino acid protecting reagent
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-4-methylpentanoic acid
Fmoc-protected amino acid for peptide synthesis
Fmoc-N-(2,4-dimethoxybenzyl)-Gly-OH
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-Propargylglycine
Fmoc-protected amino acid for peptide synthesis
3-((Acetamidomethyl)sulfanyl)-N-(((9H-fluoren-9-yl)methoxy)carbonyl)-L-valine
Fmoc-protected amino acid for peptide synthesis
Methyl 4-nitro-1H-pyrazole-5-carboxylate
pharmaceutical intermediate
(2R,3S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
Peptide synthesis building block
2-cyclopropyl-2-oxoacetic acid
Pharmaceutical intermediate
(2S,3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid
IQIOLCJHRZWOLS-XOBRGWDASA-N
CC[C@H](C)[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13