Di(ethylene-d8 glycol) is a deuterium-labeled compound used as a reference standard in analytical research. Its structure contains hydroxyl and ether groups, and it is primarily employed in studies requiring precise isotopic tracing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Di(ethylene-d8 glycol) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,4-Di(hydroxymethyl)benzene-d4
deuterated reference standard
2,2',5,5'-tetrachlorobiphenyl-3,4,6-d3
deuterated reference standard
2-[Bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide
deuterated reference standard
1,5-dinitronaphthalene-d6
deuterated reference standard
Allyl-d5 alcohol
Deuterated research reagent
Propyl-d7 alcohol
deuterated research standard
Allyl-d5 bromide
deuterated alkylating reagent
Magnesium chloride 3,4-dimethylbenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
1,1,2,2-tetradeuterio-2-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)ethanol
MTHSVFCYNBDYFN-SVYQBANQSA-N
[2H]C([2H])(C([2H])([2H])OC([2H])([2H])C([2H])([2H])O)O
Di(ethylene-d8 glycol) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.