Allyl-d5 alcohol is a deuterated research reagent used primarily in laboratory settings. It is a labeled form of allyl alcohol where five hydrogen atoms are replaced by deuterium, allowing for tracing studies in chemical and biological research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Allyl-d5 alcohol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Iodotoluene-d7
Deuterated research reagent
4-Fluorobenzonitrile-d4
Deuterated research reagent
2-Methyl-1,4-naphthalenediol-d8
Deuterated research reagent
1-Bromo-3-chloropropane-d6
Deuterated research reagent
Propyl-d7 alcohol
deuterated research standard
Allyl-d5 bromide
deuterated alkylating reagent
Magnesium chloride 3,4-dimethylbenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
1-(1-Ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Research compound for synthesis
Allyl-d5 alcohol(CAS 102910-30-5)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,2,3,3-pentadeuterioprop-2-en-1-ol
XXROGKLTLUQVRX-RHPBTXKOSA-N
[2H]C(=C([2H])C([2H])([2H])O)[2H]
Allyl-d5 alcohol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.