Propyl-d7 alcohol is a deuterated research standard, specifically This compound, used as a labeled compound in analytical and laboratory research. Its significance lies in its application as an internal standard or tracer in mass spectrometry and nuclear magnetic resonance (NMR) studies due to the incorporation of seven deuterium atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 102910-31-6
Allyl-d5 bromide
deuterated alkylating reagent
Magnesium chloride 3,4-dimethylbenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
1-(1-Ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Research compound for synthesis
N-Cyclohexyltaurine
biological buffer reagent
1-프로판올
solvent and disinfecting agent
1,1,2,2,3,3,3-heptadeuteriopropan-1-ol
BDERNNFJNOPAEC-NCKGIQLSSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])O