Propyl-d7 alcohol is a deuterated research standard, specifically This compound, used as a labeled compound in analytical and laboratory research. Its significance lies in its application as an internal standard or tracer in mass spectrometry and nuclear magnetic resonance (NMR) studies due to the incorporation of seven deuterium atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Propyl-d7 alcohol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Allyl-d5 bromide
deuterated alkylating reagent
Magnesium chloride 3,4-dimethylbenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
1-(1-Ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Research compound for synthesis
N-Cyclohexyltaurine
biological buffer reagent
1-프로판올
solvent and disinfecting agent
Propyl-d7 alcohol(CAS 102910-31-6)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,2,2,3,3,3-heptadeuteriopropan-1-ol
BDERNNFJNOPAEC-NCKGIQLSSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])O
Propyl-d7 alcohol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.