DL-Glutamic-2,4,4-D3 acid is a deuterium-labeled research standard used for analytical and metabolic studies. Its structure incorporates three deuterium atoms at specific positions, enabling precise tracking in mass spectrometry and nuclear magnetic resonance experiments.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 96927-56-9
DL-Cysteine hydrochloride monohydrate
research compound
(+)-Gallocatechin
reference standard for analytical testing
2,5-HEXANEDIONE-D10
deuterated research compound
Benzyl (2R)-hydroxy(phenyl)acetate
Research compound
Monopotassium L-glutamate monohydrate
Flavor enhancer
L-Glutamic Acid-d5
Deuterated amino acid analytical standard
Monosodium DL-glutamate
flavor enhancer
L-glutamic acid
nutritional supplement and flavor enhancer
2-amino-2,4,4-trideuteriopentanedioic acid
WHUUTDBJXJRKMK-UHVFUKFASA-N
[2H]C([2H])(CC([2H])(C(=O)O)N)C(=O)O