L-Glutamic Acid-d5 is a deuterated form of the amino acid L-glutamic acid, commonly used as an analytical standard in research. Its isotopic labeling enables precise quantification in mass spectrometry and nuclear magnetic resonance studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2784-50-1
L-Glutamine-d5
stable isotope labeled research standard
Aldoview precursor
research compound
Acetamide, N-[2-(5-methoxy-1-nitroso-1H-indol-3-yl)ethyl]-
Nitrosamine reference standard
Integrin Binding Peptide
integrin binding research reagent
N-Nitrosocarbazole
Nitrosamine impurity reference standard
Monosodium DL-glutamate
flavor enhancer
L-glutamic acid
nutritional supplement and flavor enhancer
Sodium glutamate monohydrate
flavor enhancer
(2S)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid
WHUUTDBJXJRKMK-NKXUJHECSA-N
[2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)O)N