DL-Tartaric-2,3-d2 acid is a deuterium-labeled form of tartaric acid used as a research standard. Its primary significance lies in its application as an internal standard or tracer in analytical chemistry and metabolic studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 91469-46-4
1-Amino-3-cyclopentene hydrochloride
Research compound
2-FLUORO-N-METHYL-4-NITROBENZAMIDE
research compound
(S)-3-(4-(5-Bromo-2-chlorobenzyl)phenoxy)tetrahydrofuran
research compound
Peracetyl Empagliflozin
acetylated empagliflozin research compound
2,3-Dihydroxybutanedioic acid
Acidity regulator and synergist for antioxidants
D-Tartaric acid
Synergist for antioxidants and flavoring agent
AMMONIUM BITARTRATE
food acidity regulator
Ammonium L-(+)-Tartrate
food additive and buffering agent
2,3-dideuterio-2,3-dihydroxybutanedioic acid
FEWJPZIEWOKRBE-QDNHWIQGSA-N
[2H]C(C(=O)O)(C([2H])(C(=O)O)O)O