This compound is a peptide research reagent consisting of a protected dipeptide structure featuring two proline residues with a benzyloxycarbonyl (Cbz) protecting group. Its primary significance lies in its use as a specialized synthetic intermediate for peptide-related studies and chemical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7360-23-8
Carbobenzoxyproline
Protected amino acid intermediate
N-(Carbobenzyloxy)-DL-proline
research compound
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
1-Carbobenzoxy-2-piperidinecarboxylic Acid
pharmaceutical intermediate for peptide synthesis
Triethylamine trihydrofluoride
fluorinating reagent for organic synthesis
Butyric-d7 acid
Deuterated research reference standard
5-ANDROSTEN-3BETA,17BETA-DIOL-16,16,17-D3
isotopically labeled research standard
N-Tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid
biological buffer substance
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
GEAZFVPWHCGNLW-UHFFFAOYSA-N
C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O