N-(Benzyloxycarbonyl)-D-proline, commonly referred to as Cbz-D-Pro-OH, is a protected amino acid derivative used as a reagent in peptide synthesis. Its significance lies in its role as a protecting group reagent, where the benzyloxycarbonyl (Cbz) group temporarily shields the amino function during peptide chain assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6404-31-5
1-Carbobenzoxy-2-piperidinecarboxylic Acid
pharmaceutical intermediate for peptide synthesis
(S)-1-N-Cbz-Pipecolinic acid
Pharmaceutical intermediate for peptide synthesis
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
Peptide research compound
(S)-1-N-Cbz-prolinamide
Protected proline derivative for peptide synthesis
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
N-Benzyloxycarbonyl-L-leucine
Peptide synthesis protecting group reagent
3-Hydroxypiperidine hydrochloride
Pharmaceutical intermediate for drug synthesis
(3aR,4R,5R,6aS)-5-((tert-Butyldimethylsilyl)oxy)-4-((E)-3-oxooct-1-en-1-yl)hexahydro-2H-cyclopenta[b]furan-2-one
Pharmaceutical intermediate for prostaglandin synthesis
(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
JXGVXCZADZNAMJ-LLVKDONJSA-N
C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O