Carbobenzoxyproline is a protected amino acid derivative commonly used in peptide synthesis. It features a carbobenzoxy (Cbz) protecting group attached to the nitrogen of proline, making it a valuable intermediate in pharmaceutical manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1148-11-4
(S)-1-N-Cbz-Pipecolinic acid
Pharmaceutical intermediate for peptide synthesis
1-Carbobenzoxy-2-piperidinecarboxylic Acid
pharmaceutical intermediate for peptide synthesis
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
Peptide research compound
(S)-1-N-Cbz-prolinamide
Protected proline derivative for peptide synthesis
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoic acid
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
N-(tert-Butoxycarbonyl)-L-cyclohexylglycine
Protected amino acid intermediate
(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
JXGVXCZADZNAMJ-NSHDSACASA-N
C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O