2,2'-Bipyridine-4,4'-dicarboxylic acid is a bifunctional organic compound featuring two carboxylic acid groups attached to a bipyridine core. It is primarily used as a ligand in coordination chemistry to form metal-organic frameworks and hydrogen-bonded networks, as described in coordination and structural studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen Sie 2,2'-Bipyridine-4,4'-dicarboxylic acid?
Stellen Sie kostenlos eine Kaufanfrage — ohne Konto. Sie erreicht Lieferanten dieses Produkts; Antworten gehen direkt in Ihr Postfach.
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
2,9-DIBROMO-1,10-PHENANTHROLINE
research compound for coordination chemistry
Pyridine-3,5-dicarboxylic acid
research compound for coordination chemistry
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
SPDP
heterobifunctional crosslinking reagent
P-Nitrophenyl phosphate di(tris(hydroxymethyl)methylamine) salt
phosphatase substrate
POPSO
biological buffer reagent
2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid
FXPLCAKVOYHAJA-UHFFFAOYSA-N
C1=CN=C(C=C1C(=O)O)C2=NC=CC(=C2)C(=O)O
Beschaffen Sie 2,2'-Bipyridine-4,4'-dicarboxylic acid?
Stellen Sie kostenlos eine Kaufanfrage — ohne Konto. Sie erreicht Lieferanten dieses Produkts; Antworten gehen direkt in Ihr Postfach.