POPSO is a zwitterionic sulfonic acid compound commonly used as a biological buffer reagent in biochemical and molecular biology research. Its structure contains two hydroxyl and two sulfonic acid groups, providing effective buffering capacity in physiological pH ranges.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 68189-43-5
1-Piperazinepropanesulfonic acid, .beta.-hydroxy-4-(2-hydroxyethyl)-
N-(2-hydroxyethyl)piperazine buffer reagent
Mopso
biological buffering agent
TES sodium salt
biological buffer reagent
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
ADA sodium salt
biological buffer reagent
2-BROMO-6-CHLOROTHIENO[2,3-B]PYRIDINE
Research reagent
4,6-dichloro-3-methylpyridazine
research compound
2-hydroxy-3-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid
LVQFQZZGTZFUNF-UHFFFAOYSA-N
C1CN(CCN1CC(CS(=O)(=O)O)O)CC(CS(=O)(=O)O)O