4-Morpholinepropanesulfonic acid, sodium salt is a chemical compound used as a biological buffer reagent. It is commonly employed in biochemical and molecular biology research to maintain stable pH conditions.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 71119-22-7
MES sodium salt
Buffering agent for biochemical research
MES potassium salt
biological buffer reagent
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
N-Cyclohexyltaurine
biological buffer reagent
ADA sodium salt
biological buffer reagent
TAPSO sodium salt
biological buffer reagent
N-[(2S)-4-amino-1-[[(2S,3R)-1-[[(2S)-4-amino-1-oxo-1-[[(3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-[(1R)-1-hydroxyethyl]-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]octanamide
research compound
Hibiscetin 3,7,4'-trimethyl ether
Research compound
sodium 3-morpholin-4-ylpropane-1-sulfonate
MWEMXEWFLIDTSJ-UHFFFAOYSA-M
C1COCCN1CCCS(=O)(=O)[O-].[Na+]