TAPSO sodium salt is a sodium salt of a sulfonic acid buffering agent. It is commonly utilized as a biological buffer reagent in research and laboratory settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 105140-25-8
MES potassium salt
biological buffer reagent
DIPSO sodium salt
biological buffer reagent
POPSO
biological buffer reagent
TES sodium salt
biological buffer reagent
5-Chloroindole-2-carboxylic acid
indolyl carboxylic acid reagent
3,5-Difluorophenylacetic acid
research compound
2-Propenoic acid, 2-phosphonoxy-, monocyclohexylammonium salt
Research compound
Guanosine 5'-triphosphate-5'-adenosine
Nucleoside polyphosphate research reagent
sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate
XRADYQRMWVBZEH-UHFFFAOYSA-M
C(C(CS(=O)(=O)[O-])O)NC(CO)(CO)CO.[Na+]