Pyridine-3,5-dicarboxylic acid is a dicarboxylic acid derivative of pyridine. Its structure features two carboxylic acid groups and an aromatic heterocyclic ring, making it a useful ligand for coordination chemistry research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen Sie Pyridine-3,5-dicarboxylic acid?
Stellen Sie kostenlos eine Kaufanfrage — ohne Konto. Sie erreicht Lieferanten dieses Produkts; Antworten gehen direkt in Ihr Postfach.
5-Hydroxynicotinic acid
Research reagent
2,9-DIBROMO-1,10-PHENANTHROLINE
research compound for coordination chemistry
2,2'-Bipyridine-4,4'-dicarboxylic acid
research compound for coordination chemistry
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
Guanidine hydrochloride
Laboratory chemical research reagent
Coumalic acid
research compound
3,5-Dimethoxyphenol
chemical standard and research compound
2-Bromo-2'-chloroacetophenone
chemical synthesis intermediate
Der internationale HS-Code für Pyridine-3,5-dicarboxylic acid (CAS 499-81-0) lautet 2933.39.
2933.39
2933 39 99
Einreihung gemäß dem EU-Zollverzeichnis ECICS (Stand 2026-07, HS 2022). Nationale Tariflinien und die Erzeugnisform können die endgültige Einreihung beeinflussen.
pyridine-3,5-dicarboxylic acid
MPFLRYZEEAQMLQ-UHFFFAOYSA-N
C1=C(C=NC=C1C(=O)O)C(=O)O
Beschaffen Sie Pyridine-3,5-dicarboxylic acid?
Stellen Sie kostenlos eine Kaufanfrage — ohne Konto. Sie erreicht Lieferanten dieses Produkts; Antworten gehen direkt in Ihr Postfach.