2,6-Dichlorophenylacetic acid is a chlorinated aromatic carboxylic acid used as a research reagent in organic synthesis. Its structure features a dichlorophenyl ring attached to an acetic acid moiety, contributing to its utility as a building block for further chemical transformations.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6575-24-2
2-Fluoro-3-(trifluoromethyl)pyridine
research compound
5-Bromo-4-chloro-3-indolyl phosphate p-toluidine salt
Biochemical staining reagent
2,6-Dichlorobenzenesulfonyl chloride
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
2-(2,6-dichlorophenyl)acetic acid
SFAILOOQFZNOAU-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)CC(=O)O)Cl