4-(Trifluoromethoxy)benzyl Chloride is a chemical compound that serves as a research reagent. It is characterized by the presence of a chloromethyl group and a trifluoromethoxy substituent on an aromatic ring, making it useful in laboratory-scale synthesis and exploratory chemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 65796-00-1
4-Nitrophenyl trifluoroacetate
Research reagent for peptide synthesis
Glycyl-L-tyrosine
dipeptide research compound
3,4-Difluorophenylacetic acid
research compound
4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
research compound
1-(chloromethyl)-4-(trifluoromethoxy)benzene
LBMKFQMJURUPKC-UHFFFAOYSA-N
C1=CC(=CC=C1CCl)OC(F)(F)F
—