This compound is a chiral research compound featuring an amine group and two ether substituents on an aromatic ring. It is primarily used as a laboratory reagent for chemical and pharmacological studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 64778-78-5
Quinoline-3-carboxylic acid
research compound
Val-Leu-Arg-p-nitroanilide
chromogenic substrate for enzyme assays
Methyl 4-bromo-5-formylthiophene-2-carboxylate
Research compound
Leuphasyl
research compound
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine
research compound for serotonin receptor studies
(2R)-1-(3,4-dimethoxyphenyl)propan-2-amine
KAZPHAGSWZTKDW-MRVPVSSYSA-N
C[C@H](CC1=CC(=C(C=C1)OC)OC)N