Leuphasyl is a peptide-based compound used primarily as a research reagent. It is a pentapeptide derivative with a specific stereochemistry, characterized by multiple amide bonds and a phenolic side chain, and is supplied for laboratory and research purposes.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 64963-01-5
L-Aspartic acid, L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucyl-
research compound
Leu-enkephalin
active pharmaceutical ingredient
Orotic acid
Biochemical research for nucleic acid biosynthesis
Magnesium chloride ethyn-1-ide (1/1/1)
Grignard reagent for organic synthesis
[Ru(bpm)3][Cl]2, AldrichCPR
research compound
1,4-Bis(dicyclohexylphosphino)butane
phosphine ligand for catalysis
MET-enkephalin
endogenous opioid peptide
L-Tyrosine, L-lysyl-L-lysyl-L-lysyl-L-leucyl-L-arginyl-L-arginyl-L-glutaminyl-L-|A-glutamyl-L-alanyl-L-phenylalanyl-L-|A-aspartyl-L-alanyl-
peptide research reagent
(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid
ZHUJMSMQIPIPTF-JMBSJVKXSA-N
C[C@H](C(=O)NCC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CC2=CC=C(C=C2)O)N