Quinoline-3-carboxylic acid is a research compound featuring a quinoline ring system with a carboxylic acid substituent. It is primarily used as a laboratory reagent for chemical and biological studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6480-68-8
Val-Leu-Arg-p-nitroanilide
chromogenic substrate for enzyme assays
Methyl 4-bromo-5-formylthiophene-2-carboxylate
Research compound
Leuphasyl
research compound
Orotic acid
Biochemical research for nucleic acid biosynthesis
quinoline-3-carboxylic acid
DJXNJVFEFSWHLY-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(C=N2)C(=O)O