4-Bromo-2-fluoro-1,1'-biphenyl is a brominated and fluorinated biphenyl compound used as a pharmaceutical intermediate. It is primarily supplied for use in chemical synthesis and pharmaceutical manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 41604-19-7
Allopurinol Impurity 9
Allopurinol impurity reference standard
Beta-D-Galactose pentaacetate
Pharmaceutical intermediate for carbohydrate chemistry
(2,3,4,5,6-2H5)Aniline
Pharmaceutical intermediate
4-Piperidone
pharmaceutical intermediate
4-bromo-2-fluoro-1-phenylbenzene
HTRNHWBOBYFTQF-UHFFFAOYSA-N
C1=CC=C(C=C1)C2=C(C=C(C=C2)Br)F