Beta-D-Galactose pentaacetate is a peracetylated derivative of galactose commonly used as a pharmaceutical intermediate in carbohydrate chemistry. Its structure features a fully acetylated galactopyranose ring, which serves as a protected building block for the synthesis of complex oligosaccharides and glycoconjugates.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4163-60-4
1,2,3,5-Tetraacetyl-beta-D-ribofuranose
Pharmaceutical intermediate for nucleoside synthesis
(2R,3S,4S,5S)-5-(Acetoxymethyl)tetrahydrofuran-2,3,4-triyl triacetate
sugar protecting group intermediate
(2,3,4,5,6-2H5)Aniline
Pharmaceutical intermediate
4-Piperidone
pharmaceutical intermediate
5,6-Dichloronicotinic acid
Pharmaceutical intermediate
5-Bromo-6-oxo-1,6-dihydropyridine-3-carboxylic acid
pharmaceutical intermediate
[(2R,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate
LPTITAGPBXDDGR-LYYZXLFJSA-N
CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C