This compound is a deuterium-labeled aniline derivative, specifically the pentadeuterio form of aniline, where all five aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of isotopically labeled compounds for research and development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4165-61-1
4-Piperidone
pharmaceutical intermediate
5,6-Dichloronicotinic acid
Pharmaceutical intermediate
5-Bromo-6-oxo-1,6-dihydropyridine-3-carboxylic acid
pharmaceutical intermediate
2,4-Dichlorothiazole
Pharmaceutical intermediate
ANILINE
chemical intermediate for dyes and polymers
(2H7)Aniline
Deuterated research reagent
2,3,4,5,6-pentadeuterioaniline
PAYRUJLWNCNPSJ-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N)[2H])[2H]