Bucladesine sodium is a research reagent used as a phosphodiesterase inhibitor. It is a salt form of a cyclic nucleotide analog, featuring a complex ring structure and polar functional groups suitable for laboratory studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 16980-89-5
Bucladesine Calcium
research compound
6-Bromo-5,7-difluoroindoline-2,3-dione
research compound
2-Amino-4-bromo-3,5-difluorobenzoic acid
Research compound
Ethyl thiooxamate
research chemical
4-methyl-2-(propan-2-yl)pyridin-3-amine
research compound
Cyclic AMP
research reagent
8-Bromo-cAMP sodium salt
research compound
sodium [(4aR,6R,7R,7aR)-6-[6-(butanoylamino)purin-9-yl]-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl] butanoate
KRBZRVBLIUDQNG-JBVYASIDSA-M
CCCC(=O)NC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@H]4[C@H](O3)COP(=O)(O4)[O-])OC(=O)CCC.[Na+]