8-Bromo-cAMP sodium salt is a brominated derivative of cyclic adenosine monophosphate (cAMP) used as a research compound. It is commonly employed in laboratory studies to investigate cellular signaling pathways, particularly those involving protein kinases.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 76939-46-3
2-Fluoro-4-methylbenzoic acid
research chemical intermediate
2-chloro-4-methylbenzoic acid
research compound
3-Bromo-4-methylbenzoic acid
synthetic intermediate for organic chemistry
2,2-DIMETHOXYPROPANE
dehydrating agent in microscopy specimen preparation
Cyclic AMP
research reagent
Bucladesine Calcium
research compound
Bucladesine sodium
phosphodiesterase inhibitor research tool
sodium (4aR,6R,7R,7aS)-6-(6-amino-8-bromopurin-9-yl)-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol
DMRMZQATXPQOTP-GWTDSMLYSA-M
C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C4=NC=NC(=C4N=C3Br)N)O)OP(=O)(O1)[O-].[Na+]