Harbin Y-11
This compound is a quaternary ammonium salt with a tricyclic cage structure, commonly used as a research reagent. It features an alcohol functional group and is typically supplied as a bromide salt for laboratory applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1086639-59-9
9,9-dimethyl-9H-fluoren-2-amine
research compound
Dibenzothiophene-4-boronic acid
boronic acid research reagent
Thianthren-2-ylboronic acid
research chemical
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanol bromide
HBPXFHNNLMCUPA-UHFFFAOYSA-M
C1N2CN3CN1C[N+](C2)(C3)CCO.[Br-]