9,9-Dimethyl-9H-fluoren-2-amine is a research compound featuring a fluorene core with a dimethyl substituent at the 9-position and an amino group. It is primarily used in laboratory settings as a building block for chemical synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 108714-73-4
Dibenzothiophene-4-boronic acid
boronic acid research reagent
Thianthren-2-ylboronic acid
research chemical
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
9,9-dimethylfluoren-2-amine
GUTJITRKAMCHSD-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N)C