Thianthren-2-ylboronic acid is a boronic acid derivative of thianthrene, a sulfur-containing heterocyclic compound. It is typically used as a research chemical in laboratory settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 108847-21-8
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
Bortrifluoriddiethyletherat
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
Thianthren
research compound for phosphorescence studies
thianthren-2-ylboronic acid
GCSOJZMPHLRBMJ-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)SC3=CC=CC=C3S2)(O)O