Isophthaloyl chloride is a chemical compound primarily used as an intermediate in the production of dyes and synthetic fibers. It features a benzene ring with two acid chloride functional groups, making it reactive in polymer and dye synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 99-63-8
3-Chlorobenzoyl chloride
Pharmaceutical intermediate
1,3-Dinitrobenzene
intermediate for dyes and explosives
Irganox 565
Antioxidant stabilizing agent
1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane
Fluorinated solvent or intermediate
(3-methyloxetan-3-yl)methyl 4-methylbenzenesulfonate
benzenesulfonate ester intermediate
benzene-1,3-dicarbonyl chloride
FDQSRULYDNDXQB-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl