3,4-Dichlorobenzenesulfonyl chloride is a chemical compound used primarily as a sulfonyl chloride intermediate in industrial and research settings. Its structure features a dichlorinated aromatic ring bonded to a sulfonyl chloride group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 98-31-7
2-amino-4-sulfobenzoic acid
chemical intermediate for synthesis
4-tert-Butylcyclohexanone
chemical intermediate for agrochemicals and fragrances
4-tert-Butylphenol
Intermediate for resins and antioxidants
4-Chlorobenzotrifluoride
Chemical intermediate and solvent
3,4-dichlorobenzenesulfonyl chloride
NYIBPWGZGSXURD-UHFFFAOYSA-N
C1=CC(=C(C=C1S(=O)(=O)Cl)Cl)Cl
—