S-adenosylhomocysteine is an organic sulfide that serves as the S-adenosyl derivative of L-homocysteine. It functions as a cofactor and a fundamental metabolite in biochemical processes, and is known to inhibit certain methyltransferases and synthases.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 979-92-0
4-Hydroxyisoleucine
Biochemical research reagent
Sulfuric acid--7H-purin-6-amine--water (1/2/2)
Biochemical research reagent
D-Glucopyranuronic acid
Biochemical research reagent
N-Acetyl-D-mannosamine hydrate
Biochemical research reagent
2-Thiophenecarboxaldehyde
organic synthesis building block
4-Iodobenzenesulfonyl chloride
research reagent for sulfonylation
4-Nitrobenzenesulfonyl chloride
Detection and characterization reagent
3-Oxocyclopentanecarboxylic acid
research compound
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid
ZJUKTBDSGOFHSH-WFMPWKQPSA-N
C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CSCC[C@@H](C(=O)O)N)O)O)N