Ethyl chrysanthemate is an ester compound that functions as a monoterpenoid. It is primarily used as an intermediate in the production of synthetic pyrethroid insecticides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 97-41-6
(4S)-4-(2-Chlorophenyl)-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphinane 2-oxide
herbicide intermediate
1,3,2-Dioxaphosphorinane, 4-(2-chlorophenyl)-2-hydroxy-5,5-dimethyl-, 2-oxide, (4R)-
Organophosphorus fungicide or pesticide
Ethanone, 2,2-dichloro-1-(2,3-dihydro-3-methyl-4H-1,4-benzoxazin-4-yl)-
herbicide safener
2,6-DICHLORO-4-NITROANILINE
Selective agricultural fungicide
ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
VIMXTGUGWLAOFZ-UHFFFAOYSA-N
CCOC(=O)C1C(C1(C)C)C=C(C)C