1-Chloro-2,4-dinitrobenzene is a chemical compound used in the manufacture of dyes and pesticides. It has a structure containing aromatic rings, nitro groups, and a chlorine atom, which contribute to its reactivity in industrial chemical processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 97-00-7
Methyl alpha-D-glucopyranoside
Plasticizer and surfactant intermediate
1,3-Di-o-tolylguanidine
rubber accelerator
Ethyl methacrylate
Monomer for polymer production
Itaconic acid
Copolymerization monomer and resin intermediate
1-chloro-2,4-dinitrobenzene
VYZAHLCBVHPDDF-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])Cl