3-Nitrophthalamide is a chemical compound featuring a benzene ring substituted with two amide groups and a nitro group. It serves as a research chemical intermediate in laboratory and industrial settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 96385-50-1
3-bromo-5-chloroaniline
research compound
4-Nitrophenyl 4,6-ethylidene-a-D-maltoheptaoside
chromogenic substrate for enzyme assays
3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid
research compound
3-Methoxy-4-hydroxyphenylethylamine hydrochloride
research compound
3-nitrobenzene-1,2-dicarboxamide
GMOAOEGBMSRFFQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)C(=O)N