2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride is a research compound featuring a dichlorophenyl ring and a fluorine-substituted ethanamine group. Its structure includes an amine functional group and multiple halogens, and it is supplied as a hydrochloride salt for laboratory use.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 960053-41-2
(4-Aminophenyl)boronic acid hydrate
Research reagent for boronic acid chemistry
Propan-2-yl prop-2-ynoate
research compound
2'-deoxyguanosine
research compound for oxidative stress studies
2,4,6-Tri-tert-butylaniline
research compound
2-(2,4-dichlorophenyl)-2-fluoroethanamine;hydrochloride
PBEKPQSMDQIZFJ-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)Cl)C(CN)F.Cl
—