1-Amino Hydantoin-13C3 is a carbon-13 isotopically labeled derivative of 1-amino hydantoin, used primarily as an analytical standard in research and laboratory settings. Its isotopic labeling facilitates precise quantification and tracing in mass spectrometry and related analytical applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 957509-31-8
2-NP-SCA 13C,15N2
isotopically labeled research compound
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-nitro-L-phenylalanine
Peptide synthesis intermediate
Fmoc-Ile-Thr(Psi(Me,Me)pro)-OH
research reagent for peptide synthesis
Fmoc-Glu(OtBu)-Thr(psi(Me,Me)pro)-OH
synthetic peptide building block
1-Aminohydantoin hydrochloride
research compound for chemical synthesis
1-amino-(2,4,5-13C3)1,3-diazolidine-2,4-dione
KVYKDNGUEZRPGJ-VMIGTVKRSA-N
[13CH2]1[13C](=O)N[13C](=O)N1N