p-Nitrophenylalanine is a derivative of L-phenylalanine where a nitro group is attached at the 4-position of the phenyl ring. It is used primarily as a research compound.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 949-99-5
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid;hydrate
Pharmaceutical intermediate for peptide synthesis
2,4-Difluorocinnamic acid
research compound for crystal engineering
2-Methoxyestrone-1,4,16,16-d4
Deuterated analytical reference standard
Sodium 2-[(difluoromethyl)sulfanyl]acetate
Research reagent
5-Norbornene-2-methanol
olefin metathesis research reagent
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid
GTVVZTAFGPQSPC-QMMMGPOBSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)[N+](=O)[O-]