1,3,5-triisopropenyl benzene is an organic compound featuring a benzene ring substituted with three isopropenyl groups. It is primarily used as a monomer or crosslinking agent in polymer chemistry and materials science.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 949-47-3
1,3,5-tris(prop-1-en-2-yl)benzene
CWABICBDFJMISP-UHFFFAOYSA-N
CC(=C)C1=CC(=CC(=C1)C(=C)C)C(=C)C