This compound is a fluorinated methacrylate monomer, specifically this compound. It is used as a research reagent in polymer chemistry for the synthesis of fluorinated polymers with specialized properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 944480-10-8
2-[2-(2-Propynyloxy)ethoxy]ethylamine
Click chemistry building block
6-BROMO-2,3-DIHYDRO-3-BENZOFURANAMINE
research compound
4-[[[(6S)-2-Amino-5-formyl-3,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl]methyl]amino]benzoic acid
research compound
D-Phenylalanyl Nateglinide
research compound
[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] 2-methylprop-2-enoate
BKUNBDQVOHMIAE-UHFFFAOYSA-N
CC(=C)C(=O)OC(C)(C)C(C(F)(F)F)(C(F)(F)F)O
—