2-Chloronaphthalene-d7 is a deuterated analytical reference standard used primarily in research and analytical chemistry. It consists of a chlorinated naphthalene molecule where all seven hydrogen atoms are replaced with deuterium, making it valuable for mass spectrometry and isotope-labeling studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 2-Chloronaphthalene-d7؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Dimethyl phthalate-3,4,5,6-d4
Deuterated research standard
3,3'-dichlorobenzidine-d6
research reagent or reference standard
2-Naphthalen-1,3,4,5,6,7,8-d7-amine
Isotopically labeled research compound
Acenaphthylene D8
deuterated internal standard for analytical chemistry
2-CHLORONAPHTHALENE
chlorinated naphthalene industrial chemical
2-chloro-1,3,4,5,6,7,8-heptadeuterionaphthalene
CGYGETOMCSJHJU-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])Cl)[2H])[2H])[2H]
هل تبحث عن شراء 2-Chloronaphthalene-d7؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.