2-Chloronaphthalene-d7 is a deuterated analytical reference standard used primarily in research and analytical chemistry. It consists of a chlorinated naphthalene molecule where all seven hydrogen atoms are replaced with deuterium, making it valuable for mass spectrometry and isotope-labeling studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93951-84-9
Dimethyl phthalate-3,4,5,6-d4
Deuterated research standard
3,3'-dichlorobenzidine-d6
research reagent or reference standard
2-Naphthalen-1,3,4,5,6,7,8-d7-amine
Isotopically labeled research compound
Acenaphthylene D8
deuterated internal standard for analytical chemistry
2-CHLORONAPHTHALENE
chlorinated naphthalene industrial chemical
2-chloro-1,3,4,5,6,7,8-heptadeuterionaphthalene
CGYGETOMCSJHJU-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])Cl)[2H])[2H])[2H]