2,3,4,6-Tetrachloroanisole is a chlorinated aromatic compound known primarily as a contaminant that can cause cork taint and wine faults, leading to unpleasant sensory characteristics in affected beverages. It is associated with musty or moldy odors in wine and is studied in the context of food and beverage quality control.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 938-22-7
1,2,3,5-tetrachloro-4-methoxybenzene
ITXDBGLYYSJNPK-UHFFFAOYSA-N
COC1=C(C(=C(C=C1Cl)Cl)Cl)Cl