2,4,6-Trimethylbenzoyl chloride is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring substituted with three methyl groups and an acyl chloride functional group, contributing to its reactivity in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 938-18-1
2-amino-2-(4-hydroxyphenyl)acetic acid
Pharmaceutical intermediate for antibiotic synthesis
3-Morpholino-1-(2-thienyl)propan-1-one hydrochloride
Pharmaceutical intermediate for cloperastine
Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate intermediate
(3-Chloropyrazin-2-yl)methanamine hydrochloride
Pharmaceutical intermediate
2,4,6-trimethylbenzoyl chloride
UKRQMDIFLKHCRO-UHFFFAOYSA-N
CC1=CC(=C(C(=C1)C)C(=O)Cl)C