N-tert-butoxycarbonyl-3-iodo-L-alanine methyl ester is a chemical compound used as a pharmaceutical intermediate in the manufacture of active pharmaceutical ingredients. It features an iodine atom and protected amino acid structure, making it suitable for peptide synthesis and related applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93267-04-0
5-bromo-3-[[(2R)-1-methyl-2-pyrrolidinyl]methyl]-1H-Indole
Pharmaceutical intermediate for APIs
{3-[(tert-butoxy)carbonyl]phenyl}boronic acid
Pharmaceutical intermediate for APIs
4-Amino-5-chloro-2-methoxybenzoic acid
Pharmaceutical intermediate for APIs
O-Toluoyl chloride
Pharmaceutical intermediate
6,6'-(9H-Fluoren-9-ylidene)bis(2-naphthalenol)
pharmaceutical intermediate
2-Chlorotrityl chloride
Pharmaceutical intermediate
1-Chloroadamantane
pharmaceutical intermediate for amantadine synthesis
methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
UGZBFCCHLUWCQI-LURJTMIESA-N
CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OC