5-Carboxyfluorescein N-succinimidyl ester is a cell-permeable fluorescent dye that reacts with primary amines, commonly used in cell proliferation research. Its acetate-modified form, CFDA-SE, enhances cell permeability at the cost of fluorescence until intracellular activation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 92557-80-7
3'-AZido-2'3'-ddCTP
research compound for antiviral studies
2-Aminoethyl hydrogen sulfate
research compound
3-oxopropanoic acid
Research chemical and metabolite standard
Isobutylmagnesium Bromide
Grignard reagent for carbon-carbon bond formation
(2,5-dioxopyrrolidin-1-yl) 3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate
GECIDMICWWDIBO-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)C2=CC3=C(C=C2)C4(C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O)OC3=O