This compound is an industrial chemical used as a UV absorber in personal care products. Its structure incorporates an aromatic benzotriazole ring and a sulfonate group, which contribute to its ability to absorb ultraviolet light.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 92484-48-5
Diethyl 2,2'-thiodiacetate
chemical intermediate for thioester synthesis
Sebacic acid dihydrazide
crosslinking agent for polymers
Propane, 2-(ethenyloxy)-2-methyl-
Vinyl ether monomer
Tert-Butyl peroxypivalate
polymerization initiator
2-(2H-Benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol
UV absorber additive
2-(2'-hydroxy-5'-methacryloxyethylphenyl)-2h-benzotriazole
UV absorber intermediate
2,4-Di-tert-butyl-6-(5-chloro-2H-benzotriazol-2-yl)phenol
UV absorber for plastics
Tinuvin
UV stabilizer for plastics
sodium 3-(benzotriazol-2-yl)-5-butan-2-yl-4-hydroxybenzenesulfonate
XTXADMXOEMEPAC-UHFFFAOYSA-M
CCC(C)C1=C(C(=CC(=C1)S(=O)(=O)[O-])N2N=C3C=CC=CC3=N2)O.[Na+]