Methylnaltrexone bromide, (17S)-, is a quaternary ammonium salt compound that acts as a peripheral mu-opioid receptor antagonist. It is a pharmaceutical raw material derived from naltrexone, characterized by a positively charged nitrogen atom that limits its ability to cross the blood-brain barrier.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 916045-21-1
2-Tolperisone Hydrochloride
centrally acting skeletal muscle relaxant
Bromfenac
nonsteroidal anti-inflammatory drug
Letermovir
antiviral active pharmaceutical ingredient
Cefdinir
active pharmaceutical ingredient
(3S,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one bromide
IFGIYSGOEZJNBE-LHJYHSJWSA-N
C[N@+]1(CC[C@]23[C@@H]4C(=O)CC[C@]2([C@H]1CC5=C3C(=C(C=C5)O)O4)O)CC6CC6.[Br-]