(S)-Ethyl 2-amino-4-phenylbutanoate hydrochloride is a chemical compound used as a pharmaceutical intermediate in the manufacturing of certain antihypertensive agents, specifically angiotensin converting enzyme (ACE) inhibitors. This salt-form compound features an amine, an aromatic ring, and an ester group, and is supplied for research and production applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 90891-21-7
3-AMINO-2-BROMO-5-CHLOROPYRIDINE
Pharmaceutical Intermediate
2,5-Dibromopyridin-3-amine
Pharmaceutical intermediate
3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine
Pharmaceutical intermediate for sGC stimulators
Diethyl pyrrolidine-2,5-dicarboxylate--hydrogen chloride (1/1)
pharmaceutical intermediate
ethyl (2S)-2-amino-4-phenylbutanoate;hydrochloride
PTFKZMFFSIYCOV-MERQFXBCSA-N
CCOC(=O)[C@H](CCC1=CC=CC=C1)N.Cl