4-(Methylsulfonyl)phenylacetic acid is a chemical compound used as a pharmaceutical intermediate. Its structure includes a phenyl ring substituted with a methylsulfonyl group and an acetic acid moiety, as characterized by crystallographic analysis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 90536-66-6
2-(4-aminophenyl)-1lambda6,2-thiazolidine-1,1-dione
Pharmaceutical intermediate for impurity synthesis
N-(Methylsulfonyl)-4-(desnitro) Nimesulide
Pharmaceutical reference standard impurity
(2S)-2-{[(tert-butoxy)carbonyl]amino}pent-4-enoic acid
Boc-protected amino acid intermediate
1-benzhydrylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
2-(4-methylsulfonylphenyl)acetic acid
HGGWOSYNRVOQJH-UHFFFAOYSA-N
CS(=O)(=O)C1=CC=C(C=C1)CC(=O)O