Triclopyricarb is a carbamate ester fungicide used as an antifungal agrochemical, primarily on rice and other crops. It functions as a mitochondrial cytochrome-bc1 complex inhibitor.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 902760-40-1
3-(((2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)phenyl)sulfonyl)amino)-1H-1,2,4-triazole-5-carboxylic acid
Herbicide metabolite
CHLORIMURON-ETHYL
sulfonylurea herbicide for soybeans and peanuts
4-Dodecyl-2,6-dimethylmorpholine
antifungal agrochemical
Lambda-Cyhalothrin
Pyrethroid insecticide
6-Benzyloxypyridine-3-boronic acid
Pharmaceutical intermediate for boronic acid synthesis
(6-benzyloxy-2-fluoro-3-pyridyl)-pentafluoro-sulfane
research compound
(6-benzyloxy-2-pyridyl)-pentafluoro-sulfane
research compound
methyl N-methoxy-N-[2-[(3,5,6-trichloro-2-pyridinyl)oxymethyl]phenyl]carbamate
QFNFRZHOXWNWAQ-UHFFFAOYSA-N
COC(=O)N(C1=CC=CC=C1COC2=NC(=C(C=C2Cl)Cl)Cl)OC