Benzhydryl chloride is a chlorinated organic compound consisting of a diphenylmethyl structure with a chlorine atom attached to the central carbon. It is primarily used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 90-99-3
4-Chlorobenzhydryl chloride
Pharmaceutical intermediate for synthesis
Ethyl ((1R,3aR,4aR,6R,8aR,9S,9aS)-9-(diphenylcarbamoyl)-1-methyl-3-oxododecahydronaphtho[2,3-c]furan-6-yl)carbamate
pharmaceutical intermediate
(3R,3aR,4S,4aR,7R,8aR,9aR)-7-((Ethoxycarbonyl)amino)-3-methyl-1-oxododecahydronaphtho[2,3-c]furan-4-carboxylic acid
Pharmaceutical intermediate
2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol
pharmaceutical excipient and coating agent
Ethylene glycol monostearate
surfactant and emulsifier in pharmaceuticals
[chloro(phenyl)methyl]benzene
ZDVDCDLBOLSVGM-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl